C9H16N2O2 — CID 139900973
ethyl 2,3,5-trimethyl-1H-pyrazole-3-carboxylate (PubChem CID 139900973) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is ethyl 2,3,5-trimethyl-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 2,3,5-trimethyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 139900973 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | ethyl 2,3,5-trimethyl-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1(C)C=C(C)NN1C |
| InChI | InChI=1S/C9H16N2O2/c1-5-13-8(12)9(3)6-7(2)10-11(9)4/h6,10H,5H2,1-4H3 |
| InChIKey | UQEAFRAKZHIOSC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |