C18H22O6 — CID 86584743
tert-butyl 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate;furan-2,5-dione (PubChem CID 86584743) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is tert-butyl 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate;furan-2,5-dione.
| Compound Name | tert-butyl 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate;furan-2,5-dione |
|---|---|
| PubChem CID | 86584743 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | tert-butyl 3-(2-bicyclo[2.2.1]hept-5-enyl)oxirane-2-carboxylate;furan-2,5-dione |
| SMILES | CC(C)(C)OC(=O)C1OC1C1CC2C=CC1C2.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C14H20O3.C4H2O3/c1-14(2,3)17-13(15)12-11(16-12)10-7-8-4-5-9(10)6-8;5-3-1-2-4(6)7-3/h4-5,8-12H,6-7H2,1-3H3;1-2H |
| InChIKey | VUWWORIXXMFPKF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|