C17H19NO — CID 112648458
3-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)aniline (PubChem CID 112648458) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)aniline.
| Compound Name | 3-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)aniline |
|---|---|
| PubChem CID | 112648458 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-methyl-5-(5,6,7,8-tetrahydronaphthalen-2-yloxy)aniline |
| SMILES | Cc1cc(N)cc(Oc2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C17H19NO/c1-12-8-15(18)11-17(9-12)19-16-7-6-13-4-2-3-5-14(13)10-16/h6-11H,2-5,18H2,1H3 |
| InChIKey | WTCDNODODMFNDT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|