C13H11Br3N2 — CID 112650051
2,4,6-tribromo-N-[(3-methyl-2-pyridinyl)methyl]aniline (PubChem CID 112650051) has the molecular formula C13H11Br3N2 and a molecular weight of 434.96 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(3-methyl-2-pyridinyl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(3-methyl-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 112650051 |
| Molecular Formula | C13H11Br3N2 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 431.85 |
| IUPAC Name | 2,4,6-tribromo-N-[(3-methyl-2-pyridinyl)methyl]aniline |
| SMILES | Cc1cccnc1CNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br3N2/c1-8-3-2-4-17-12(8)7-18-13-10(15)5-9(14)6-11(13)16/h2-6,18H,7H2,1H3 |
| InChIKey | GUVIDKJGZXCQPN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |