C13H10Cl2N4S — CID 115981921
3,5-dichloro-N-[(3-methyl-2-pyridinyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 115981921) has the molecular formula C13H10Cl2N4S and a molecular weight of 325.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3-methyl-2-pyridinyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-[(3-methyl-2-pyridinyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 115981921 |
| Molecular Formula | C13H10Cl2N4S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3,5-dichloro-N-[(3-methyl-2-pyridinyl)methyl]-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | Cc1cccnc1CNc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C13H10Cl2N4S/c1-7-3-2-4-16-10(7)6-17-11-8(14)5-9(15)12-13(11)19-20-18-12/h2-5,17H,6H2,1H3 |
| InChIKey | ARUWBCWZVPWCLQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |