C15H17ClN4O — CID 114437860
5-chloro-2-(cyclopropylmethyl)-4-[(3-methyl-2-pyridinyl)methylamino]pyridazin-3-one (PubChem CID 114437860) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 5-chloro-2-(cyclopropylmethyl)-4-[(3-methyl-2-pyridinyl)methylamino]pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclopropylmethyl)-4-[(3-methyl-2-pyridinyl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114437860 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 5-chloro-2-(cyclopropylmethyl)-4-[(3-methyl-2-pyridinyl)methylamino]pyridazin-3-one |
| SMILES | Cc1cccnc1CNc1c(Cl)cnn(CC2CC2)c1=O |
| InChI | InChI=1S/C15H17ClN4O/c1-10-3-2-6-17-13(10)8-18-14-12(16)7-19-20(15(14)21)9-11-4-5-11/h2-3,6-7,11,18H,4-5,8-9H2,1H3 |
| InChIKey | LKEKDIRPOQBJHY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |