C10H12ClN7O — CID 114436443
5-chloro-2-(cyclopropylmethyl)-4-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one (PubChem CID 114436443) has the molecular formula C10H12ClN7O and a molecular weight of 281.71 g/mol. Its IUPAC name is 5-chloro-2-(cyclopropylmethyl)-4-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclopropylmethyl)-4-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114436443 |
| Molecular Formula | C10H12ClN7O |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-chloro-2-(cyclopropylmethyl)-4-(2H-tetrazol-5-ylmethylamino)pyridazin-3-one |
| SMILES | O=c1c(NCc2nn[nH]n2)c(Cl)cnn1CC1CC1 |
| InChI | InChI=1S/C10H12ClN7O/c11-7-3-13-18(5-6-1-2-6)10(19)9(7)12-4-8-14-16-17-15-8/h3,6,12H,1-2,4-5H2,(H,14,15,16,17) |
| InChIKey | CDBROSPILSOYSH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |