C11H15ClN4O3 — CID 106177775
3-[[5-chloro-2-(cyclopropylmethyl)-3-oxopyridazin-4-yl]amino]-2-hydroxypropanamide (PubChem CID 106177775) has the molecular formula C11H15ClN4O3 and a molecular weight of 286.72 g/mol. Its IUPAC name is 3-[[5-chloro-2-(cyclopropylmethyl)-3-oxopyridazin-4-yl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[5-chloro-2-(cyclopropylmethyl)-3-oxopyridazin-4-yl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106177775 |
| Molecular Formula | C11H15ClN4O3 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-[[5-chloro-2-(cyclopropylmethyl)-3-oxopyridazin-4-yl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1c(Cl)cnn(CC2CC2)c1=O |
| InChI | InChI=1S/C11H15ClN4O3/c12-7-3-15-16(5-6-1-2-6)11(19)9(7)14-4-8(17)10(13)18/h3,6,8,14,17H,1-2,4-5H2,(H2,13,18) |
| InChIKey | NKGXZHIVFBNLEI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |