C11H14N2O3S — CID 112650449
2-formamido-3-[(3-methyl-2-pyridinyl)methylsulfanyl]propanoic acid (PubChem CID 112650449) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-formamido-3-[(3-methyl-2-pyridinyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-formamido-3-[(3-methyl-2-pyridinyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 112650449 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-formamido-3-[(3-methyl-2-pyridinyl)methylsulfanyl]propanoic acid |
| SMILES | Cc1cccnc1CSCC(NC=O)C(=O)O |
| InChI | InChI=1S/C11H14N2O3S/c1-8-3-2-4-12-9(8)5-17-6-10(11(15)16)13-7-14/h2-4,7,10H,5-6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | NPAIYJZJYNCFHR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|