C10H10Cl2N2O3S — CID 106994686
3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2-formamidopropanoic acid (PubChem CID 106994686) has the molecular formula C10H10Cl2N2O3S and a molecular weight of 309.17 g/mol. Its IUPAC name is 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2-formamidopropanoic acid.
| Compound Name | 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2-formamidopropanoic acid |
|---|---|
| PubChem CID | 106994686 |
| Molecular Formula | C10H10Cl2N2O3S |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 3-[(2,6-dichloro-3-pyridinyl)methylsulfanyl]-2-formamidopropanoic acid |
| SMILES | O=CNC(CSCc1ccc(Cl)nc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10Cl2N2O3S/c11-8-2-1-6(9(12)14-8)3-18-4-7(10(16)17)13-5-15/h1-2,5,7H,3-4H2,(H,13,15)(H,16,17) |
| InChIKey | PULSWRLKNINXSZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|