C11H15N3O3S — CID 66153490
3-[(3-cyclopropylimidazol-4-yl)methylsulfanyl]-2-formamidopropanoic acid (PubChem CID 66153490) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-[(3-cyclopropylimidazol-4-yl)methylsulfanyl]-2-formamidopropanoic acid.
| Compound Name | 3-[(3-cyclopropylimidazol-4-yl)methylsulfanyl]-2-formamidopropanoic acid |
|---|---|
| PubChem CID | 66153490 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-[(3-cyclopropylimidazol-4-yl)methylsulfanyl]-2-formamidopropanoic acid |
| SMILES | O=CNC(CSCc1cncn1C1CC1)C(=O)O |
| InChI | InChI=1S/C11H15N3O3S/c15-7-13-10(11(16)17)5-18-4-9-3-12-6-14(9)8-1-2-8/h3,6-8,10H,1-2,4-5H2,(H,13,15)(H,16,17) |
| InChIKey | YFBWJLLXGMSZBA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|