C16H14Cl2N2O4S — CID 166396478
3-(2,6-dichloro-3-pyridinyl)-2-[[(E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 166396478) has the molecular formula C16H14Cl2N2O4S and a molecular weight of 401.27 g/mol. Its IUPAC name is 3-(2,6-dichloro-3-pyridinyl)-2-[[(E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-(2,6-dichloro-3-pyridinyl)-2-[[(E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 166396478 |
| Molecular Formula | C16H14Cl2N2O4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 3-(2,6-dichloro-3-pyridinyl)-2-[[(E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(/C=C/SCc1ccco1)NC(Cc1ccc(Cl)nc1Cl)C(=O)O |
| InChI | InChI=1S/C16H14Cl2N2O4S/c17-13-4-3-10(15(18)20-13)8-12(16(22)23)19-14(21)5-7-25-9-11-2-1-6-24-11/h1-7,12H,8-9H2,(H,19,21)(H,22,23)/b7-5+ |
| InChIKey | AJJUMSUNTKALHN-FNORWQNLSA-N |
| XLogP | 3.54 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|