C16H17NO2S2 — CID 3803224
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-phenylsulfanylprop-2-enamide (PubChem CID 3803224) has the molecular formula C16H17NO2S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-phenylsulfanylprop-2-enamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-phenylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 3803224 |
| Molecular Formula | C16H17NO2S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-phenylsulfanylprop-2-enamide |
| SMILES | O=C(C=CSc1ccccc1)NCCSCc1ccco1 |
| InChI | InChI=1S/C16H17NO2S2/c18-16(8-11-21-15-6-2-1-3-7-15)17-9-12-20-13-14-5-4-10-19-14/h1-8,10-11H,9,12-13H2,(H,17,18) |
| InChIKey | DHDRSYPSZUDBOR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|