C12H13ClN2O5S — CID 79555853
4-[(5-chloro-2-nitrophenyl)methylsulfanyl]-2-formamidobutanoic acid (PubChem CID 79555853) has the molecular formula C12H13ClN2O5S and a molecular weight of 332.77 g/mol. Its IUPAC name is 4-[(5-chloro-2-nitrophenyl)methylsulfanyl]-2-formamidobutanoic acid.
| Compound Name | 4-[(5-chloro-2-nitrophenyl)methylsulfanyl]-2-formamidobutanoic acid |
|---|---|
| PubChem CID | 79555853 |
| Molecular Formula | C12H13ClN2O5S |
| Molecular Weight | 332.77 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-[(5-chloro-2-nitrophenyl)methylsulfanyl]-2-formamidobutanoic acid |
| SMILES | O=CNC(CCSCc1cc(Cl)ccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C12H13ClN2O5S/c13-9-1-2-11(15(19)20)8(5-9)6-21-4-3-10(12(17)18)14-7-16/h1-2,5,7,10H,3-4,6H2,(H,14,16)(H,17,18) |
| InChIKey | GJJNROFXWIOXFA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|