C9H11Cl2NO2S2 — CID 106994829
2,6-dichloro-3-(2-methylsulfonylethylsulfanylmethyl)pyridine (PubChem CID 106994829) has the molecular formula C9H11Cl2NO2S2 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,6-dichloro-3-(2-methylsulfonylethylsulfanylmethyl)pyridine.
| Compound Name | 2,6-dichloro-3-(2-methylsulfonylethylsulfanylmethyl)pyridine |
|---|---|
| PubChem CID | 106994829 |
| Molecular Formula | C9H11Cl2NO2S2 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 2,6-dichloro-3-(2-methylsulfonylethylsulfanylmethyl)pyridine |
| SMILES | CS(=O)(=O)CCSCc1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C9H11Cl2NO2S2/c1-16(13,14)5-4-15-6-7-2-3-8(10)12-9(7)11/h2-3H,4-6H2,1H3 |
| InChIKey | USGCWQQXTKUPIJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|