C13H18N2O3 — CID 11265192
(2R,3S)-5,5-bis(1H-pyrrol-2-yl)pentane-1,2,3-triol (PubChem CID 11265192) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (2R,3S)-5,5-bis(1H-pyrrol-2-yl)pentane-1,2,3-triol.
| Compound Name | (2R,3S)-5,5-bis(1H-pyrrol-2-yl)pentane-1,2,3-triol |
|---|---|
| PubChem CID | 11265192 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (2R,3S)-5,5-bis(1H-pyrrol-2-yl)pentane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)CC(c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C13H18N2O3/c16-8-13(18)12(17)7-9(10-3-1-5-14-10)11-4-2-6-15-11/h1-6,9,12-18H,7-8H2/t12-,13+/m0/s1 |
| InChIKey | HPYJMBMPOHEWSO-QWHCGFSZSA-N |
| XLogP | 0.58 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |