C13H18ClFN2OS — CID 112652288
3-[(2-chloro-3-fluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide (PubChem CID 112652288) has the molecular formula C13H18ClFN2OS and a molecular weight of 304.82 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide.
| Compound Name | 3-[(2-chloro-3-fluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 112652288 |
| Molecular Formula | C13H18ClFN2OS |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[(2-chloro-3-fluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H18ClFN2OS/c1-18-8-7-17(6-5-12(16)19)9-10-3-2-4-11(15)13(10)14/h2-4H,5-9H2,1H3,(H2,16,19) |
| InChIKey | ZHRMNDYYOBKBOG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|