C13H18F2N2OS — CID 114930223
3-[(2,6-difluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide (PubChem CID 114930223) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide.
| Compound Name | 3-[(2,6-difluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide |
|---|---|
| PubChem CID | 114930223 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methyl-(2-methoxyethyl)amino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H18F2N2OS/c1-18-8-7-17(6-5-13(16)19)9-10-11(14)3-2-4-12(10)15/h2-4H,5-9H2,1H3,(H2,16,19) |
| InChIKey | XNSNDGXAEWBURO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|