C13H14ClFN2O2 — CID 112654102
1-[(2-chloro-3-fluorophenyl)methyl]-3-ethylpiperazine-2,6-dione (PubChem CID 112654102) has the molecular formula C13H14ClFN2O2 and a molecular weight of 284.72 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 112654102 |
| Molecular Formula | C13H14ClFN2O2 |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1NCC(=O)N(Cc2cccc(F)c2Cl)C1=O |
| InChI | InChI=1S/C13H14ClFN2O2/c1-2-10-13(19)17(11(18)6-16-10)7-8-4-3-5-9(15)12(8)14/h3-5,10,16H,2,6-7H2,1H3 |
| InChIKey | BQLMBKFNXKJAOM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|