C13H13Cl2FN2 — CID 112654315
1-[(2-chloro-3-fluorophenyl)methyl]-4-(1-chloropropyl)pyrazole (PubChem CID 112654315) has the molecular formula C13H13Cl2FN2 and a molecular weight of 287.17 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methyl]-4-(1-chloropropyl)pyrazole.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methyl]-4-(1-chloropropyl)pyrazole |
|---|---|
| PubChem CID | 112654315 |
| Molecular Formula | C13H13Cl2FN2 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methyl]-4-(1-chloropropyl)pyrazole |
| SMILES | CCC(Cl)c1cnn(Cc2cccc(F)c2Cl)c1 |
| InChI | InChI=1S/C13H13Cl2FN2/c1-2-11(14)10-6-17-18(8-10)7-9-4-3-5-12(16)13(9)15/h3-6,8,11H,2,7H2,1H3 |
| InChIKey | ALUSQIJMIHLGBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|