C13H16BrClFN — CID 112654432
1-(3-bromocyclobutyl)-N-[(2-chloro-3-fluorophenyl)methyl]-N-methylmethanamine (PubChem CID 112654432) has the molecular formula C13H16BrClFN and a molecular weight of 320.63 g/mol. Its IUPAC name is 1-(3-bromocyclobutyl)-N-[(2-chloro-3-fluorophenyl)methyl]-N-methylmethanamine.
| Compound Name | 1-(3-bromocyclobutyl)-N-[(2-chloro-3-fluorophenyl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 112654432 |
| Molecular Formula | C13H16BrClFN |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 1-(3-bromocyclobutyl)-N-[(2-chloro-3-fluorophenyl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1cccc(F)c1Cl)CC1CC(Br)C1 |
| InChI | InChI=1S/C13H16BrClFN/c1-17(7-9-5-11(14)6-9)8-10-3-2-4-12(16)13(10)15/h2-4,9,11H,5-8H2,1H3 |
| InChIKey | ISHDDPAOGOIAEN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|