C13H16Cl3F — CID 112654957
1-[2,2-bis(chloromethyl)pentyl]-2-chloro-3-fluorobenzene (PubChem CID 112654957) has the molecular formula C13H16Cl3F and a molecular weight of 297.63 g/mol. Its IUPAC name is 1-[2,2-bis(chloromethyl)pentyl]-2-chloro-3-fluorobenzene.
| Compound Name | 1-[2,2-bis(chloromethyl)pentyl]-2-chloro-3-fluorobenzene |
|---|---|
| PubChem CID | 112654957 |
| Molecular Formula | C13H16Cl3F |
| Molecular Weight | 297.63 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 1-[2,2-bis(chloromethyl)pentyl]-2-chloro-3-fluorobenzene |
| SMILES | CCCC(CCl)(CCl)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H16Cl3F/c1-2-6-13(8-14,9-15)7-10-4-3-5-11(17)12(10)16/h3-5H,2,6-9H2,1H3 |
| InChIKey | UQYIFMVTURSKJK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|