C12H14N4OS — CID 11265499
methyl N,N-dimethyl-N'-(4-oxoquinazolin-3-yl)carbamimidothioate (PubChem CID 11265499) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is methyl N,N-dimethyl-N'-(4-oxoquinazolin-3-yl)carbamimidothioate.
| Compound Name | methyl N,N-dimethyl-N'-(4-oxoquinazolin-3-yl)carbamimidothioate |
|---|---|
| PubChem CID | 11265499 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl N,N-dimethyl-N'-(4-oxoquinazolin-3-yl)carbamimidothioate |
| SMILES | CS/C(=N\n1cnc2ccccc2c1=O)N(C)C |
| InChI | InChI=1S/C12H14N4OS/c1-15(2)12(18-3)14-16-8-13-10-7-5-4-6-9(10)11(16)17/h4-8H,1-3H3/b14-12- |
| InChIKey | IDIZYPKLHLXJAK-OWBHPGMISA-N |
| XLogP | 1.44 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|