C11H15ClFNO2S — CID 112655118
1-[(2-chloro-3-fluorophenyl)methylsulfonyl]butan-2-amine (PubChem CID 112655118) has the molecular formula C11H15ClFNO2S and a molecular weight of 279.76 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methylsulfonyl]butan-2-amine.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methylsulfonyl]butan-2-amine |
|---|---|
| PubChem CID | 112655118 |
| Molecular Formula | C11H15ClFNO2S |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methylsulfonyl]butan-2-amine |
| SMILES | CCC(N)CS(=O)(=O)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C11H15ClFNO2S/c1-2-9(14)7-17(15,16)6-8-4-3-5-10(13)11(8)12/h3-5,9H,2,6-7,14H2,1H3 |
| InChIKey | XBVUWEKKZZZTCR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |