C13H17N3 — CID 112655264
4-N,2-diethylquinoline-4,6-diamine (PubChem CID 112655264) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-N,2-diethylquinoline-4,6-diamine.
| Compound Name | 4-N,2-diethylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 112655264 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-N,2-diethylquinoline-4,6-diamine |
| SMILES | CCNc1cc(CC)nc2ccc(N)cc12 |
| InChI | InChI=1S/C13H17N3/c1-3-10-8-13(15-4-2)11-7-9(14)5-6-12(11)16-10/h5-8H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | JEIISMKPHSFEQD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|