C12H26N2OS — CID 112658408
4-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)oxan-4-amine (PubChem CID 112658408) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)oxan-4-amine.
| Compound Name | 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)oxan-4-amine |
|---|---|
| PubChem CID | 112658408 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)oxan-4-amine |
| SMILES | CCC(CSC)N(C)C1(CN)CCOCC1 |
| InChI | InChI=1S/C12H26N2OS/c1-4-11(9-16-3)14(2)12(10-13)5-7-15-8-6-12/h11H,4-10,13H2,1-3H3 |
| InChIKey | VITUJGDGJMOJLO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |