C17H36N2S — CID 115985690
1-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propan-2-ylcycloheptan-1-amine (PubChem CID 115985690) has the molecular formula C17H36N2S and a molecular weight of 300.56 g/mol. Its IUPAC name is 1-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propan-2-ylcycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propan-2-ylcycloheptan-1-amine |
|---|---|
| PubChem CID | 115985690 |
| Molecular Formula | C17H36N2S |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 1-(aminomethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propan-2-ylcycloheptan-1-amine |
| SMILES | CCC(CSC)N(C)C1(CN)CCCC(C(C)C)CC1 |
| InChI | InChI=1S/C17H36N2S/c1-6-16(12-20-5)19(4)17(13-18)10-7-8-15(9-11-17)14(2)3/h14-16H,6-13,18H2,1-5H3 |
| InChIKey | QIOPJIZCQUTFEV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |