C10H20N2OS2 — CID 112659658
2-carbamothioyl-N-methyl-N-(1-methylsulfanylpropan-2-yl)butanamide (PubChem CID 112659658) has the molecular formula C10H20N2OS2 and a molecular weight of 248.42 g/mol. Its IUPAC name is 2-carbamothioyl-N-methyl-N-(1-methylsulfanylpropan-2-yl)butanamide.
| Compound Name | 2-carbamothioyl-N-methyl-N-(1-methylsulfanylpropan-2-yl)butanamide |
|---|---|
| PubChem CID | 112659658 |
| Molecular Formula | C10H20N2OS2 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-carbamothioyl-N-methyl-N-(1-methylsulfanylpropan-2-yl)butanamide |
| SMILES | CCC(C(=O)N(C)C(C)CSC)C(N)=S |
| InChI | InChI=1S/C10H20N2OS2/c1-5-8(9(11)14)10(13)12(3)7(2)6-15-4/h7-8H,5-6H2,1-4H3,(H2,11,14) |
| InChIKey | MHAIHHVWOPSBKB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|