C13H26N2S — CID 112660736
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-methyl-2-methylsulfanylethanamine (PubChem CID 112660736) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-methyl-2-methylsulfanylethanamine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 112660736 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-methyl-2-methylsulfanylethanamine |
| SMILES | CSCCN(C)CC1CC2CCCCC2N1 |
| InChI | InChI=1S/C13H26N2S/c1-15(7-8-16-2)10-12-9-11-5-3-4-6-13(11)14-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | FLFASLDJQUTVQT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |