C14H26N2 — CID 43264303
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-ethylcyclopropanamine (PubChem CID 43264303) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-ethylcyclopropanamine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-ethylcyclopropanamine |
|---|---|
| PubChem CID | 43264303 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-N-ethylcyclopropanamine |
| SMILES | CCN(CC1CC2CCCCC2N1)C1CC1 |
| InChI | InChI=1S/C14H26N2/c1-2-16(13-7-8-13)10-12-9-11-5-3-4-6-14(11)15-12/h11-15H,2-10H2,1H3 |
| InChIKey | UPMWHOFGCDJZHD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |