C14H22O6 — CID 11266144
ethyl (2E,5S,6E)-5-(2-methoxyethoxymethoxy)-8-oxoocta-2,6-dienoate (PubChem CID 11266144) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is ethyl (2E,5S,6E)-5-(2-methoxyethoxymethoxy)-8-oxoocta-2,6-dienoate.
| Compound Name | ethyl (2E,5S,6E)-5-(2-methoxyethoxymethoxy)-8-oxoocta-2,6-dienoate |
|---|---|
| PubChem CID | 11266144 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl (2E,5S,6E)-5-(2-methoxyethoxymethoxy)-8-oxoocta-2,6-dienoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](/C=C/C=O)OCOCCOC |
| InChI | InChI=1S/C14H22O6/c1-3-19-14(16)8-4-6-13(7-5-9-15)20-12-18-11-10-17-2/h4-5,7-9,13H,3,6,10-12H2,1-2H3/b7-5+,8-4+/t13-/m0/s1 |
| InChIKey | FURKLCBSVCNYSX-JSUGOYOUSA-N |
| XLogP | 1.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|