C10H18O6 — CID 134937644
methyl (E)-4,4,5,5-tetramethoxypent-2-enoate (PubChem CID 134937644) has the molecular formula C10H18O6 and a molecular weight of 234.25 g/mol. Its IUPAC name is methyl (E)-4,4,5,5-tetramethoxypent-2-enoate.
| Compound Name | methyl (E)-4,4,5,5-tetramethoxypent-2-enoate |
|---|---|
| PubChem CID | 134937644 |
| Molecular Formula | C10H18O6 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | methyl (E)-4,4,5,5-tetramethoxypent-2-enoate |
| SMILES | COC(=O)/C=C/C(OC)(OC)C(OC)OC |
| InChI | InChI=1S/C10H18O6/c1-12-8(11)6-7-10(15-4,16-5)9(13-2)14-3/h6-7,9H,1-5H3/b7-6+ |
| InChIKey | OIDAEUPCWXSCLC-VOTSOKGWSA-N |
| XLogP | 0.32 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|