C8H17NO2S — CID 112661463
2-methyl-3-[methyl(2-methylsulfanylethyl)amino]propanoic acid (PubChem CID 112661463) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-methyl-3-[methyl(2-methylsulfanylethyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl(2-methylsulfanylethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 112661463 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-methyl-3-[methyl(2-methylsulfanylethyl)amino]propanoic acid |
| SMILES | CSCCN(C)CC(C)C(=O)O |
| InChI | InChI=1S/C8H17NO2S/c1-7(8(10)11)6-9(2)4-5-12-3/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | NRJXWJJFJYZKKY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |