C8H19NO2S — CID 112661895
2,2-dimethoxy-N-methyl-N-(2-methylsulfanylethyl)ethanamine (PubChem CID 112661895) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is 2,2-dimethoxy-N-methyl-N-(2-methylsulfanylethyl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-methyl-N-(2-methylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 112661895 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2,2-dimethoxy-N-methyl-N-(2-methylsulfanylethyl)ethanamine |
| SMILES | COC(CN(C)CCSC)OC |
| InChI | InChI=1S/C8H19NO2S/c1-9(5-6-12-4)7-8(10-2)11-3/h8H,5-7H2,1-4H3 |
| InChIKey | CWKBBDVZXMVNNA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|