C10H21N5S — CID 112665539
N-methyl-2-[4-(methylaminomethyl)triazol-1-yl]-N-(2-methylsulfanylethyl)ethanamine (PubChem CID 112665539) has the molecular formula C10H21N5S and a molecular weight of 243.38 g/mol. Its IUPAC name is N-methyl-2-[4-(methylaminomethyl)triazol-1-yl]-N-(2-methylsulfanylethyl)ethanamine.
| Compound Name | N-methyl-2-[4-(methylaminomethyl)triazol-1-yl]-N-(2-methylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 112665539 |
| Molecular Formula | C10H21N5S |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-methyl-2-[4-(methylaminomethyl)triazol-1-yl]-N-(2-methylsulfanylethyl)ethanamine |
| SMILES | CNCc1cn(CCN(C)CCSC)nn1 |
| InChI | InChI=1S/C10H21N5S/c1-11-8-10-9-15(13-12-10)5-4-14(2)6-7-16-3/h9,11H,4-8H2,1-3H3 |
| InChIKey | UKQFMVICRUFRTL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |