C14H22N6 — CID 62427263
N-methyl-N-[2-[4-(methylaminomethyl)triazol-1-yl]ethyl]-2-pyridin-4-ylethanamine (PubChem CID 62427263) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(methylaminomethyl)triazol-1-yl]ethyl]-2-pyridin-4-ylethanamine.
| Compound Name | N-methyl-N-[2-[4-(methylaminomethyl)triazol-1-yl]ethyl]-2-pyridin-4-ylethanamine |
|---|---|
| PubChem CID | 62427263 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-methyl-N-[2-[4-(methylaminomethyl)triazol-1-yl]ethyl]-2-pyridin-4-ylethanamine |
| SMILES | CNCc1cn(CCN(C)CCc2ccncc2)nn1 |
| InChI | InChI=1S/C14H22N6/c1-15-11-14-12-20(18-17-14)10-9-19(2)8-5-13-3-6-16-7-4-13/h3-4,6-7,12,15H,5,8-11H2,1-2H3 |
| InChIKey | DKNFWQNGUAPEJA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |