C12H28N2OS — CID 112666209
N-(3-ethoxypropyl)-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)ethane-1,2-diamine (PubChem CID 112666209) has the molecular formula C12H28N2OS and a molecular weight of 248.44 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(3-ethoxypropyl)-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112666209 |
| Molecular Formula | C12H28N2OS |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-(3-ethoxypropyl)-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)ethane-1,2-diamine |
| SMILES | CCOCCCNCCN(C)C(C)CSC |
| InChI | InChI=1S/C12H28N2OS/c1-5-15-10-6-7-13-8-9-14(3)12(2)11-16-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | LCMUSAWHIUTOCS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|