C15H35N3O — CID 102997787
2-N-[3-(dimethylamino)propyl]-1-N-(3-ethoxypropyl)-2-N-ethylpropane-1,2-diamine (PubChem CID 102997787) has the molecular formula C15H35N3O and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-1-N-(3-ethoxypropyl)-2-N-ethylpropane-1,2-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-1-N-(3-ethoxypropyl)-2-N-ethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 102997787 |
| Molecular Formula | C15H35N3O |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.28 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-1-N-(3-ethoxypropyl)-2-N-ethylpropane-1,2-diamine |
| SMILES | CCOCCCNCC(C)N(CC)CCCN(C)C |
| InChI | InChI=1S/C15H35N3O/c1-6-18(12-9-11-17(4)5)15(3)14-16-10-8-13-19-7-2/h15-16H,6-14H2,1-5H3 |
| InChIKey | MTGAJFZUTWWCLP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|