C15H34N2O — CID 62567824
1-N-(3-ethoxypropyl)-2-N-methyl-2-N-(4-methylpentan-2-yl)propane-1,2-diamine (PubChem CID 62567824) has the molecular formula C15H34N2O and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-N-(3-ethoxypropyl)-2-N-methyl-2-N-(4-methylpentan-2-yl)propane-1,2-diamine.
| Compound Name | 1-N-(3-ethoxypropyl)-2-N-methyl-2-N-(4-methylpentan-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 62567824 |
| Molecular Formula | C15H34N2O |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | 1-N-(3-ethoxypropyl)-2-N-methyl-2-N-(4-methylpentan-2-yl)propane-1,2-diamine |
| SMILES | CCOCCCNCC(C)N(C)C(C)CC(C)C |
| InChI | InChI=1S/C15H34N2O/c1-7-18-10-8-9-16-12-15(5)17(6)14(4)11-13(2)3/h13-16H,7-12H2,1-6H3 |
| InChIKey | KZTCJRZUZXQEIN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|