C8H20N2O — CID 62568793
1-N-(3-ethoxypropyl)propane-1,2-diamine (PubChem CID 62568793) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is 1-N-(3-ethoxypropyl)propane-1,2-diamine.
| Compound Name | 1-N-(3-ethoxypropyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 62568793 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 1-N-(3-ethoxypropyl)propane-1,2-diamine |
| SMILES | CCOCCCNCC(C)N |
| InChI | InChI=1S/C8H20N2O/c1-3-11-6-4-5-10-7-8(2)9/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | FGTIXBTYRLGHCI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|