C10H26N4O — CID 11806174
(2S)-1-N-[2-[2-[[(2S)-2-aminopropyl]amino]ethoxy]ethyl]propane-1,2-diamine (PubChem CID 11806174) has the molecular formula C10H26N4O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2S)-1-N-[2-[2-[[(2S)-2-aminopropyl]amino]ethoxy]ethyl]propane-1,2-diamine.
| Compound Name | (2S)-1-N-[2-[2-[[(2S)-2-aminopropyl]amino]ethoxy]ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 11806174 |
| Molecular Formula | C10H26N4O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.21 |
| IUPAC Name | (2S)-1-N-[2-[2-[[(2S)-2-aminopropyl]amino]ethoxy]ethyl]propane-1,2-diamine |
| SMILES | C[C@H](N)CNCCOCCNC[C@H](C)N |
| InChI | InChI=1S/C10H26N4O/c1-9(11)7-13-3-5-15-6-4-14-8-10(2)12/h9-10,13-14H,3-8,11-12H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | SYTOPIKBCPDLKR-UWVGGRQHSA-N |
| XLogP | -1.12 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|