C10H25N3O — CID 91542846
1-N-[2-[2-(dimethylamino)ethoxy]ethyl]butane-1,3-diamine (PubChem CID 91542846) has the molecular formula C10H25N3O and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]butane-1,3-diamine.
| Compound Name | 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]butane-1,3-diamine |
|---|---|
| PubChem CID | 91542846 |
| Molecular Formula | C10H25N3O |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | 1-N-[2-[2-(dimethylamino)ethoxy]ethyl]butane-1,3-diamine |
| SMILES | CC(N)CCNCCOCCN(C)C |
| InChI | InChI=1S/C10H25N3O/c1-10(11)4-5-12-6-8-14-9-7-13(2)3/h10,12H,4-9,11H2,1-3H3 |
| InChIKey | ZTBSPOCRRYLHBM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|