C10H24N2O — CID 55210850
N,N-dimethyl-3-[2-(propylamino)ethoxy]propan-1-amine (PubChem CID 55210850) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(propylamino)ethoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[2-(propylamino)ethoxy]propan-1-amine |
|---|---|
| PubChem CID | 55210850 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | N,N-dimethyl-3-[2-(propylamino)ethoxy]propan-1-amine |
| SMILES | CCCNCCOCCCN(C)C |
| InChI | InChI=1S/C10H24N2O/c1-4-6-11-7-10-13-9-5-8-12(2)3/h11H,4-10H2,1-3H3 |
| InChIKey | WLXGHJMRWNVEFQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|