C9H22N2 — CID 86664875
(3S)-1-N-(3-methylbutyl)butane-1,3-diamine (PubChem CID 86664875) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is (3S)-1-N-(3-methylbutyl)butane-1,3-diamine.
| Compound Name | (3S)-1-N-(3-methylbutyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 86664875 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | (3S)-1-N-(3-methylbutyl)butane-1,3-diamine |
| SMILES | CC(C)CCNCC[C@H](C)N |
| InChI | InChI=1S/C9H22N2/c1-8(2)4-6-11-7-5-9(3)10/h8-9,11H,4-7,10H2,1-3H3/t9-/m0/s1 |
| InChIKey | KAEWPABODPXTHS-VIFPVBQESA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|