C30H72N10 — CID 88877316
2-N,5-N-bis(3-aminobutyl)-1-N-[4-[2,5-bis(3-aminobutylamino)pentylamino]butyl]pentane-1,2,5-triamine (PubChem CID 88877316) has the molecular formula C30H72N10 and a molecular weight of 572.98 g/mol. Its IUPAC name is 2-N,5-N-bis(3-aminobutyl)-1-N-[4-[2,5-bis(3-aminobutylamino)pentylamino]butyl]pentane-1,2,5-triamine.
| Compound Name | 2-N,5-N-bis(3-aminobutyl)-1-N-[4-[2,5-bis(3-aminobutylamino)pentylamino]butyl]pentane-1,2,5-triamine |
|---|---|
| PubChem CID | 88877316 |
| Molecular Formula | C30H72N10 |
| Molecular Weight | 572.98 g/mol |
| Exact Mass | 572.59 |
| IUPAC Name | 2-N,5-N-bis(3-aminobutyl)-1-N-[4-[2,5-bis(3-aminobutylamino)pentylamino]butyl]pentane-1,2,5-triamine |
| SMILES | CC(N)CCNCCCC(CNCCCCNCC(CCCNCCC(C)N)NCCC(C)N)NCCC(C)N |
| InChI | InChI=1S/C30H72N10/c1-25(31)11-19-35-17-7-9-29(39-21-13-27(3)33)23-37-15-5-6-16-38-24-30(40-22-14-28(4)34)10-8-18-36-20-12-26(2)32/h25-30,35-40H,5-24,31-34H2,1-4H3 |
| InChIKey | WWVVXMWDQKXEOF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 176.26 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.98 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|