C24H59N9 — CID 138564477
2-N-(3-aminobutyl)-1-N-[6-[[2-(3-aminobutylamino)-5-hydrazinylpentyl]amino]hexyl]pentane-1,2,5-triamine (PubChem CID 138564477) has the molecular formula C24H59N9 and a molecular weight of 473.80 g/mol. Its IUPAC name is 2-N-(3-aminobutyl)-1-N-[6-[[2-(3-aminobutylamino)-5-hydrazinylpentyl]amino]hexyl]pentane-1,2,5-triamine.
| Compound Name | 2-N-(3-aminobutyl)-1-N-[6-[[2-(3-aminobutylamino)-5-hydrazinylpentyl]amino]hexyl]pentane-1,2,5-triamine |
|---|---|
| PubChem CID | 138564477 |
| Molecular Formula | C24H59N9 |
| Molecular Weight | 473.80 g/mol |
| Exact Mass | 473.49 |
| IUPAC Name | 2-N-(3-aminobutyl)-1-N-[6-[[2-(3-aminobutylamino)-5-hydrazinylpentyl]amino]hexyl]pentane-1,2,5-triamine |
| SMILES | CC(N)CCNC(CCCN)CNCCCCCCNCC(CCCNN)NCCC(C)N |
| InChI | InChI=1S/C24H59N9/c1-21(26)11-17-31-23(9-7-13-25)19-29-14-5-3-4-6-15-30-20-24(10-8-16-33-28)32-18-12-22(2)27/h21-24,29-33H,3-20,25-28H2,1-2H3 |
| InChIKey | ORSLCSHGNREEDW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.80 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|