C10H26N4 — CID 10805361
(2S)-1-N-(3-aminopropyl)-2-N-ethylpentane-1,2,5-triamine (PubChem CID 10805361) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is (2S)-1-N-(3-aminopropyl)-2-N-ethylpentane-1,2,5-triamine.
| Compound Name | (2S)-1-N-(3-aminopropyl)-2-N-ethylpentane-1,2,5-triamine |
|---|---|
| PubChem CID | 10805361 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | (2S)-1-N-(3-aminopropyl)-2-N-ethylpentane-1,2,5-triamine |
| SMILES | CCN[C@@H](CCCN)CNCCCN |
| InChI | InChI=1S/C10H26N4/c1-2-14-10(5-3-6-11)9-13-8-4-7-12/h10,13-14H,2-9,11-12H2,1H3/t10-/m0/s1 |
| InChIKey | IOYOTOSJJOMWJW-JTQLQIEISA-N |
| XLogP | -0.36 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|