C10H20N2 — CID 57256181
4-N-ethylocta-6,7-diene-1,4-diamine (PubChem CID 57256181) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-N-ethylocta-6,7-diene-1,4-diamine.
| Compound Name | 4-N-ethylocta-6,7-diene-1,4-diamine |
|---|---|
| PubChem CID | 57256181 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4-N-ethylocta-6,7-diene-1,4-diamine |
| SMILES | C=C=CCC(CCCN)NCC |
| InChI | InChI=1S/C10H20N2/c1-3-5-7-10(12-4-2)8-6-9-11/h5,10,12H,1,4,6-9,11H2,2H3 |
| InChIKey | NLCMUCXQPGGBLK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |