C12H31N5 — CID 54314334
3-N-[2,2-bis(ethylamino)ethyl]hexane-1,3,6-triamine (PubChem CID 54314334) has the molecular formula C12H31N5 and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-N-[2,2-bis(ethylamino)ethyl]hexane-1,3,6-triamine.
| Compound Name | 3-N-[2,2-bis(ethylamino)ethyl]hexane-1,3,6-triamine |
|---|---|
| PubChem CID | 54314334 |
| Molecular Formula | C12H31N5 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.26 |
| IUPAC Name | 3-N-[2,2-bis(ethylamino)ethyl]hexane-1,3,6-triamine |
| SMILES | CCNC(CNC(CCN)CCCN)NCC |
| InChI | InChI=1S/C12H31N5/c1-3-15-12(16-4-2)10-17-11(7-9-14)6-5-8-13/h11-12,15-17H,3-10,13-14H2,1-2H3 |
| InChIKey | SNBUPUBGYOMSJY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|