C8H18N2 — CID 61151017
1-N-(cyclopropylmethyl)butane-1,3-diamine (PubChem CID 61151017) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-N-(cyclopropylmethyl)butane-1,3-diamine.
| Compound Name | 1-N-(cyclopropylmethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 61151017 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-N-(cyclopropylmethyl)butane-1,3-diamine |
| SMILES | CC(N)CCNCC1CC1 |
| InChI | InChI=1S/C8H18N2/c1-7(9)4-5-10-6-8-2-3-8/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | DCIBLQSBHHRJAS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|